2216-94-6 Ethyl phenylpropiolate
Ürün Adı |
Ethyl phenylpropiolate |
ingilizce adı |
Ethyl phenylpropiolate; Ethyl phenylacetylenecarboxylate~Phenylpropiolic acid ethyl ester; ethyl 3-phenylprop-2-ynoate |
Moleküler Formülü |
C11H10O2 |
Molekül Ağırlığı |
174.1959 |
InChI |
InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h3-7H,2H2,1H3 |
CAS kayıt numarası |
2216-94-6 |
EINECS |
218-703-8 |
Moleküler Yapısı |
|
Yoğunluk |
1.09g/cm3 |
Kaynama noktası |
265°C at 760 mmHg |
Kırılma indisi |
1.538 |
Alevlenme noktası |
124.9°C |
Buhar basıncı |
0.0094mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|