Ürün Adı |
laurik asit, 2,2',2''-nitrilotrietanol (1:1) içeren bileşik |
Eş anlamlı |
Trietanolamin laurat; Dodekanoik asit, compd.2,2'2''-nitrilotris (etanol) (1:1) ile; Laurik asit, trietanolamin tuzu; ÇAY ÖDÜLÜ; Caswell Hayır.887A; EPA Pestisit Kimyasal Kodu 079043; Dodekanoik asit, 2,2 ', 2''-nitrilotris (etanol) (1: 1) ile oluşur; Laurik asit, 2,2',2''-nitrilotrioetanol (1:1) ile bileşik; dodekanoik asit - 2,2',2''-nitrilotrietanol (1:1);
|
ingilizce adı |
lauric acid, compound with 2,2',2''-nitrilotriethanol (1:1);Triethanolamine laurate; Dodecanoic acid, compd. with 2,2'2''-nitrilotris(ethanol) (1:1); Lauric acid, triethanolamine salt; TEA-Laurate; Caswell No. 887A; EPA Pesticide Chemical Code 079043; Dodecanoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1); Lauric acid, compound with 2,2',2''-nitrilotriethanol (1:1); dodecanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
Moleküler Formülü |
C18H39NO5 |
Molekül Ağırlığı |
349.506 |
InChI |
InChI=1/C12H24O2.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;8-4-1-7(2-5-9)3-6-10/h2-11H2,1H3,(H,13,14);8-10H,1-6H2 |
CAS kayıt numarası |
2224-49-9 |
EINECS |
218-749-9 |
Moleküler Yapısı |
|
Kaynama noktası |
296.1°C at 760 mmHg |
Alevlenme noktası |
134.1°C |
Buhar basıncı |
0.000661mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
|
|