ChemNet > CAS > 22259-30-9 formetanate
22259-30-9 formetanate
| Ürün Adı |
formetanate |
| ingilizce adı |
formetanate;Formetanate [ANSI:BSI:ISO]; Formetanate; 3-Dimethylaminomethyleneaminophenyl methylcarbamate; BRN 2807600; Carbamic acid, methyl-, m-(((dimethylamino)methylene)amino)phenyl ester; Caswell No. 465A; Dicarzol; EP 322; EPA Pesticide Chemical Code 465200; Formetanat; Methylcarbamic acid ester with N'-(m-hydroxyphenyl)-N,N-dimethylformamidine; N'-(m-Hydroxyphenyl)-N,N-dimethylformamidine methylcarbamate ester; N,N-Dimethyl-N'-(3-(((methylamino)carbonyl)oxy)phenyl)methanimidamide; m-(((Dimethylamino)methylene)amino)phenyl methylcarbamate; Carbamic acid, methyl-, ester with N'-(m-hydroxyphenyl)-N,N-dimethylformamidine; Methanimidamide, N,N-dimethyl-, N'-(3-(((methylamino)carbonyl)oxy)phenyl)-; Methanimidamide, N,N-dimethyl-N'-(3-(((methylamino)carbonyl)oxy)phenyl)-; 3-{[(Z)-(dimethylamino)methylidene]amino}phenyl methylcarbamate |
| Moleküler Formülü |
C11H15N3O2 |
| Molekül Ağırlığı |
221.2557 |
| InChI |
InChI=1/C11H15N3O2/c1-12-11(15)16-10-6-4-5-9(7-10)13-8-14(2)3/h4-8H,1-3H3,(H,12,15)/b13-8- |
| CAS kayıt numarası |
22259-30-9 |
| EINECS |
244-879-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.092g/cm3 |
| Kırılma indisi |
1.529 |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
|
|
