ChemNet > CAS > 2270-59-9 5-Bromo-2-methyl-2-pentene
2270-59-9 5-Bromo-2-methyl-2-pentene
| Ürün Adı |
5-Bromo-2-methyl-2-pentene |
| ingilizce adı |
5-Bromo-2-methyl-2-pentene; 5-bromo-2-methylpent-2-ene |
| Moleküler Formülü |
C6H11Br |
| Molekül Ağırlığı |
163.0555 |
| InChI |
InChI=1/C6H11Br/c1-6(2)4-3-5-7/h4H,3,5H2,1-2H3 |
| CAS kayıt numarası |
2270-59-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.215g/cm3 |
| Kaynama noktası |
152.6°C at 760 mmHg |
| Kırılma indisi |
1.47 |
| Alevlenme noktası |
22.8°C |
| Buhar basıncı |
4.44mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
