ChemNet > CAS > 22900-83-0 ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate
22900-83-0 ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate
| Ürün Adı |
ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate |
| ingilizce adı |
ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate; ethyl 2-bromo-4-methylthiazole-5-carboxylate |
| Moleküler Formülü |
C7H8BrNO2S |
| Molekül Ağırlığı |
250.1129 |
| InChI |
InChI=1/C7H8BrNO2S/c1-3-11-6(10)5-4(2)9-7(8)12-5/h3H2,1-2H3 |
| CAS kayıt numarası |
22900-83-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.573g/cm3 |
| Ergime noktası |
68℃ |
| Kaynama noktası |
287.086°C at 760 mmHg |
| Kırılma indisi |
1.563 |
| Alevlenme noktası |
127.426°C |
| Buhar basıncı |
0.003mmHg at 25°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
