ChemNet > CAS > 23163-84-0 2-ethoxyphenyl isothiocyanate
23163-84-0 2-ethoxyphenyl isothiocyanate
| Ürün Adı |
2-ethoxyphenyl isothiocyanate |
| ingilizce adı |
2-ethoxyphenyl isothiocyanate; o-Ethoxyphenyl isothiocyanate; 1-ethoxy-2-isothiocyanatobenzene |
| Moleküler Formülü |
C9H9NOS |
| Molekül Ağırlığı |
179.2389 |
| InChI |
InChI=1/C9H9NOS/c1-2-11-9-6-4-3-5-8(9)10-7-12/h3-6H,2H2,1H3 |
| CAS kayıt numarası |
23163-84-0 |
| EINECS |
245-468-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.06g/cm3 |
| Kaynama noktası |
293.2°C at 760 mmHg |
| Kırılma indisi |
1.544 |
| Alevlenme noktası |
131.1°C |
| Buhar basıncı |
0.00306mmHg at 25°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
