ChemNet > CAS > 233585-04-1 2,6-dihidroksi-3-nitrobenzonitril
233585-04-1 2,6-dihidroksi-3-nitrobenzonitril
Ürün Adı |
2,6-dihidroksi-3-nitrobenzonitril |
Eş anlamlı |
|
ingilizce adı |
2,6-dihydroxy-3-nitrobenzonitrile; |
Moleküler Formülü |
C7H4N2O4 |
Molekül Ağırlığı |
180.1177 |
InChI |
InChI=1/C7H4N2O4/c8-3-4-6(10)2-1-5(7(4)11)9(12)13/h1-2,10-11H |
CAS kayıt numarası |
233585-04-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.69g/cm3 |
Ergime noktası |
238℃ |
Kaynama noktası |
358.2°C at 760 mmHg |
Kırılma indisi |
1.683 |
Alevlenme noktası |
170.5°C |
Buhar basıncı |
1.25E-05mmHg at 25°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|