ChemNet > CAS > 23384-72-7 3,4-difluoropropiophenone
23384-72-7 3,4-difluoropropiophenone
Ürün Adı |
3,4-difluoropropiophenone |
ingilizce adı |
3,4-difluoropropiophenone;3',4'-Difluoropropiophenone; 1-(3,4-difluorophenyl)propan-1-one |
Moleküler Formülü |
C9H8F2O |
Molekül Ağırlığı |
170.156 |
InChI |
InChI=1/C9H8F2O/c1-2-9(12)6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3 |
CAS kayıt numarası |
23384-72-7 |
EINECS |
245-627-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.166g/cm3 |
Kaynama noktası |
225°C at 760 mmHg |
Kırılma indisi |
1.472 |
Alevlenme noktası |
84.8°C |
Buhar basıncı |
0.0886mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|