24800-44-0 Tripropylene glycol
Ürün Adı |
Tripropylene glycol |
ingilizce adı |
Tripropylene glycol; Tripropylene glycol (mixture of isomers); Tripropyleneglycol,90%; Tripropyleneglycol; TPG; 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol; 3,3'-[propane-1,2-diylbis(oxy)]dipropan-1-ol; tripropylene glycol, mixture of isomers |
Moleküler Formülü |
C9H20O4 |
Molekül Ağırlığı |
192.2527 |
InChI |
InChI=1/C9H20O4/c1-9(13-7-3-5-11)8-12-6-2-4-10/h9-11H,2-8H2,1H3 |
CAS kayıt numarası |
24800-44-0 |
EINECS |
246-466-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.038g/cm3 |
Kaynama noktası |
316.1°C at 760 mmHg |
Kırılma indisi |
1.455 |
Alevlenme noktası |
145°C |
Buhar basıncı |
3.54E-05mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
|
|