ChemNet > CAS > 25115-74-6 4-Cyano-4-phenylcyclohexanone
25115-74-6 4-Cyano-4-phenylcyclohexanone
Ürün Adı |
4-Cyano-4-phenylcyclohexanone |
ingilizce adı |
4-Cyano-4-phenylcyclohexanone; 4-oxo-1-phenylcyclohexanenitrile; 4-oxo-1-phenylcyclohexanecarbonitrile |
Moleküler Formülü |
C13H13NO |
Molekül Ağırlığı |
199.2484 |
InChI |
InChI=1/C13H13NO/c14-10-13(8-6-12(15)7-9-13)11-4-2-1-3-5-11/h1-5H,6-9H2 |
CAS kayıt numarası |
25115-74-6 |
EINECS |
246-631-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.12g/cm3 |
Ergime noktası |
114-119℃ |
Kaynama noktası |
378.6°C at 760 mmHg |
Kırılma indisi |
1.557 |
Alevlenme noktası |
182.8°C |
Buhar basıncı |
6.22E-06mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|