ChemNet > CAS > 25343-30-0 1-(2,6-Diethylphenyl)-thiourea
25343-30-0 1-(2,6-Diethylphenyl)-thiourea
Ürün Adı |
1-(2,6-Diethylphenyl)-thiourea |
ingilizce adı |
1-(2,6-Diethylphenyl)-thiourea; 2,6-Diethylphenylthiourea |
Moleküler Formülü |
C11H16N2S |
Molekül Ağırlığı |
208.3231 |
InChI |
InChI=1/C11H16N2S/c1-3-8-6-5-7-9(4-2)10(8)13-11(12)14/h5-7H,3-4H2,1-2H3,(H3,12,13,14) |
CAS kayıt numarası |
25343-30-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.137g/cm3 |
Kaynama noktası |
319.3°C at 760 mmHg |
Kırılma indisi |
1.637 |
Alevlenme noktası |
146.9°C |
Buhar basıncı |
0.000341mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R25:Toxic if swallowed.;
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|