2567-29-5 Bromoethylbiphenyl
Ürün Adı |
Bromoethylbiphenyl |
ingilizce adı |
Bromoethylbiphenyl; 4-Bromoethylbiphenyl; 4-(Bromomethyl)biphenyl; 4-Phenylbenzyl bromide |
Moleküler Formülü |
C13H11Br |
Molekül Ağırlığı |
247.1304 |
InChI |
InChI=1/C13H11Br/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2 |
CAS kayıt numarası |
2567-29-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.341g/cm3 |
Ergime noktası |
86℃ |
Kaynama noktası |
333.4°C at 760 mmHg |
Kırılma indisi |
1.605 |
Alevlenme noktası |
161.3°C |
Buhar basıncı |
0.000266mmHg at 25°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|