ChemNet > CAS > 2632-10-2 3,4-Dichlorophenacyl bromide
2632-10-2 3,4-Dichlorophenacyl bromide
Ürün Adı |
3,4-Dichlorophenacyl bromide |
ingilizce adı |
3,4-Dichlorophenacyl bromide; alpha-Bromo-3,4-dichloroacetophenone; 2-Bromo-3',4'-dichloroacetophenone; 3,4-dichlorophenacylbromide; (2,2-dichloro-1-methylcyclopropyl)benzene; 2-bromo-1-(3,4-dichlorophenyl)ethanone |
Moleküler Formülü |
C8H5BrCl2O |
Molekül Ağırlığı |
267.9347 |
InChI |
InChI=1/C8H5BrCl2O/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3H,4H2 |
CAS kayıt numarası |
2632-10-2 |
EINECS |
222-734-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.695g/cm3 |
Ergime noktası |
54-55℃ |
Kaynama noktası |
338.5°C at 760 mmHg |
Kırılma indisi |
1.596 |
Alevlenme noktası |
158.5°C |
Buhar basıncı |
9.77E-05mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|