ChemNet > CAS > 26426-80-2 poli (izobütilen-alt-maleik anhidrit)
26426-80-2 poli (izobütilen-alt-maleik anhidrit)
Ürün Adı |
poli (izobütilen-alt-maleik anhidrit) |
Eş anlamlı |
2,5-Furandion, 2-metil-1-propen içeren polimer; 2-Metil-1-propen, 2,5-furandionlu polimer; İzobutilen/MA kopolimeri; Polielektrolit 60; Maleik anhidrit, izobütilen kopolimeri; furan-2,5-dion - 2-metilprop-1-en (1:1);
|
ingilizce adı |
poly(isobutylene-alt-maleic anhydride);2,5-Furandione, polymer with 2-methyl-1-propene; 2-Methyl-1-propene, polymer with 2,5-furandione; Isobutylene/MA copolymer; Polyelectrolyte 60; Maleic anhydride, isobutylene copolymer; furan-2,5-dione - 2-methylprop-1-ene (1:1) |
Moleküler Formülü |
C8H10O3 |
Molekül Ağırlığı |
154.1632 |
InChI |
InChI=1/C4H2O3.C4H8/c5-3-1-2-4(6)7-3;1-4(2)3/h1-2H;1H2,2-3H3 |
CAS kayıt numarası |
26426-80-2 |
Moleküler Yapısı |
|
Kaynama noktası |
202°C at 760 mmHg |
Alevlenme noktası |
103.3°C |
Buhar basıncı |
0.299mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
|
|