28052-84-8 DL-5-Methoxytryptophan
| Ürün Adı |
DL-5-Methoxytryptophan |
| ingilizce adı |
DL-5-Methoxytryptophan; DL-5-Methoxytryptophane; 5-Methoxy-DL-tryptophan; 5-methoxytryptophan; 5-methoxy-D-tryptophan |
| Moleküler Formülü |
C12H14N2O3 |
| Molekül Ağırlığı |
234.2512 |
| InChI |
InChI=1/C12H14N2O3/c1-17-8-2-3-11-9(5-8)7(6-14-11)4-10(13)12(15)16/h2-3,5-6,10,14H,4,13H2,1H3,(H,15,16)/t10-/m1/s1 |
| CAS kayıt numarası |
28052-84-8 |
| EINECS |
248-800-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.347g/cm3 |
| Ergime noktası |
258-261℃ |
| Kaynama noktası |
478.3°C at 760 mmHg |
| Kırılma indisi |
1.663 |
| Alevlenme noktası |
243.1°C |
| Buhar basıncı |
5.87E-10mmHg at 25°C |
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|