ChemNet > CAS > 2855-27-8 1,2,4-Trivinylcyclohexane, mixture of isomers
2855-27-8 1,2,4-Trivinylcyclohexane, mixture of isomers
| Ürün Adı |
1,2,4-Trivinylcyclohexane, mixture of isomers |
| ingilizce adı |
1,2,4-Trivinylcyclohexane, mixture of isomers; cyclohexane-1,2,4-triyltris(ethylene); 1,2,4-Trivinyl cyclohexane = TVCH; 1,2,4-Trivinylcyclohexane; 1,2,4-triethenylcyclohexane |
| Moleküler Formülü |
C12H18 |
| Molekül Ağırlığı |
162.2713 |
| InChI |
InChI=1/C12H18/c1-4-10-7-8-11(5-2)12(6-3)9-10/h4-6,10-12H,1-3,7-9H2 |
| CAS kayıt numarası |
2855-27-8 |
| EINECS |
220-668-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.96g/cm3 |
| Kaynama noktası |
198.4°C at 760 mmHg |
| Kırılma indisi |
1.628 |
| Alevlenme noktası |
68.9°C |
| Buhar basıncı |
0.508mmHg at 25°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
