ChemNet > CAS > 287172-74-1 2-Chloro-3,6-difluorobenzoic acid
287172-74-1 2-Chloro-3,6-difluorobenzoic acid
Ürün Adı |
2-Chloro-3,6-difluorobenzoic acid |
ingilizce adı |
2-Chloro-3,6-difluorobenzoic acid; |
Moleküler Formülü |
C7H3ClF2O2 |
Molekül Ağırlığı |
192.5473 |
InChI |
InChI=1/C7H3ClF2O2/c8-6-4(10)2-1-3(9)5(6)7(11)12/h1-2H,(H,11,12) |
CAS kayıt numarası |
287172-74-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.573g/cm3 |
Kaynama noktası |
266.6°C at 760 mmHg |
Kırılma indisi |
1.534 |
Alevlenme noktası |
115°C |
Buhar basıncı |
0.00427mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|