ChemNet > CAS > 3085-42-5 4-Chlorophenyl sulfoxide
3085-42-5 4-Chlorophenyl sulfoxide
| Ürün Adı |
4-Chlorophenyl sulfoxide |
| ingilizce adı |
4-Chlorophenyl sulfoxide; Bis(4-chlorophenyl) sulfoxide; 4-Chlorophenyl sulphoxide~4,4-Dichlorodiphenyl sulphoxide; 4,4-Dichlorodiphenyl sulfoxide; 1,1'-sulfinylbis(4-chlorobenzene) |
| Moleküler Formülü |
C12H8Cl2OS |
| Molekül Ağırlığı |
271.1623 |
| InChI |
InChI=1/C12H8Cl2OS/c13-9-1-5-11(6-2-9)16(15)12-7-3-10(14)4-8-12/h1-8H |
| CAS kayıt numarası |
3085-42-5 |
| EINECS |
221-397-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.48g/cm3 |
| Ergime noktası |
140-145℃ |
| Kaynama noktası |
406.2°C at 760 mmHg |
| Kırılma indisi |
1.689 |
| Alevlenme noktası |
199.5°C |
| Buhar basıncı |
1.94E-06mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
