ChemNet > CAS > 3102-87-2 2,3,5,6-Tetramethyl-p-phenylenediamine
3102-87-2 2,3,5,6-Tetramethyl-p-phenylenediamine
| Ürün Adı |
2,3,5,6-Tetramethyl-p-phenylenediamine |
| ingilizce adı |
2,3,5,6-Tetramethyl-p-phenylenediamine; 3,6-Diaminodurene; 2,3,5,6-tetramethylbenzene-1,4-diamine; 2,3,5,6-tetramethyl-1,4-phenylenediamine |
| Moleküler Formülü |
C10H16N2 |
| Molekül Ağırlığı |
164.2474 |
| InChI |
InChI=1/C10H16N2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h11-12H2,1-4H3 |
| CAS kayıt numarası |
3102-87-2 |
| EINECS |
221-457-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.032g/cm3 |
| Ergime noktası |
150-153℃ |
| Kaynama noktası |
310.6°C at 760 mmHg |
| Kırılma indisi |
1.594 |
| Alevlenme noktası |
167.8°C |
| Buhar basıncı |
0.000595mmHg at 25°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
