3141-25-1 2,3,4-Tribromothiophene
Ürün Adı |
2,3,4-Tribromothiophene |
ingilizce adı |
2,3,4-Tribromothiophene; |
Moleküler Formülü |
C4HBr3S |
Molekül Ağırlığı |
320.8277 |
InChI |
InChI=1/C4HBr3S/c5-2-1-8-4(7)3(2)6/h1H |
CAS kayıt numarası |
3141-25-1 |
EINECS |
221-545-2 |
Moleküler Yapısı |
|
Yoğunluk |
2.516g/cm3 |
Kaynama noktası |
277.5°C at 760 mmHg |
Kırılma indisi |
1.671 |
Alevlenme noktası |
121.6°C |
Buhar basıncı |
0.00762mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|