ChemNet > CAS > 3289-28-9 Ethyl Cyclohexanecarboxylate
3289-28-9 Ethyl Cyclohexanecarboxylate
| Ürün Adı |
Ethyl Cyclohexanecarboxylate |
| ingilizce adı |
Ethyl Cyclohexanecarboxylate; Cyclohexanecarboxylic acid ethyl ester; Ethyl cyclohexane carboxylate |
| Moleküler Formülü |
C9H16O2 |
| Molekül Ağırlığı |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-2-11-9(10)8-6-4-3-5-7-8/h8H,2-7H2,1H3 |
| CAS kayıt numarası |
3289-28-9 |
| EINECS |
221-945-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.972g/cm3 |
| Kaynama noktası |
197.1°C at 760 mmHg |
| Kırılma indisi |
1.451 |
| Alevlenme noktası |
68.5°C |
| Buhar basıncı |
0.385mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
