ChemNet > CAS > 331-62-4 3-fluoro-4-methoxybenzonitrile
331-62-4 3-fluoro-4-methoxybenzonitrile
| Ürün Adı |
3-fluoro-4-methoxybenzonitrile |
| ingilizce adı |
3-fluoro-4-methoxybenzonitrile; Fluoromethoxybenzonitrile |
| Moleküler Formülü |
C8H6FNO |
| Molekül Ağırlığı |
151.1377 |
| InChI |
InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
| CAS kayıt numarası |
331-62-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.18g/cm3 |
| Kaynama noktası |
254.3°C at 760 mmHg |
| Kırılma indisi |
1.505 |
| Alevlenme noktası |
107.6°C |
| Buhar basıncı |
0.0173mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
