ChemNet > CAS > 33892-75-0 5-methoxy-1-tetralone
33892-75-0 5-methoxy-1-tetralone
| Ürün Adı |
5-methoxy-1-tetralone |
| ingilizce adı |
5-methoxy-1-tetralone; 5-methoxy-1,2,3,4-tetrahydronaphthalen-1-one; 5-Methoxy-3,4-dihydro-2H-naphthalen-1-one |
| Moleküler Formülü |
C7H8BrN |
| Molekül Ağırlığı |
186.0491 |
| InChI |
InChI=1/C7H8BrN/c1-6-3-2-4-7(5-8)9-6/h2-4H,5H2,1H3 |
| CAS kayıt numarası |
33892-75-0 |
| EINECS |
251-723-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.449g/cm3 |
| Ergime noktası |
87-91℃ |
| Kaynama noktası |
209.865°C at 760 mmHg |
| Kırılma indisi |
1.565 |
| Alevlenme noktası |
80.724°C |
| Buhar basıncı |
0.287mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
