ChemNet > CAS > 3430-23-7 3,5-Dibromo-4-methylpyridine
3430-23-7 3,5-Dibromo-4-methylpyridine
| Ürün Adı |
3,5-Dibromo-4-methylpyridine |
| ingilizce adı |
3,5-Dibromo-4-methylpyridine; 3,5-Dibromo-4-picoline |
| Moleküler Formülü |
C6H5Br2N |
| Molekül Ağırlığı |
250.9186 |
| InChI |
InChI=1/C6H5Br2N/c1-4-5(7)2-9-3-6(4)8/h2-3H,1H3 |
| CAS kayıt numarası |
3430-23-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.911g/cm3 |
| Kaynama noktası |
243°C at 760 mmHg |
| Kırılma indisi |
1.593 |
| Alevlenme noktası |
100.7°C |
| Buhar basıncı |
0.0513mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
