ChemNet > CAS > 34420-17-2 2-Phenylethyl-1-boronic acid
34420-17-2 2-Phenylethyl-1-boronic acid
Ürün Adı |
2-Phenylethyl-1-boronic acid |
ingilizce adı |
2-Phenylethyl-1-boronic acid; Phenethylboronic acid; (2-phenylethyl)boronic acid; [(E)-2-phenylethenyl]boronic acid; 2-Phenylethaneboronic acid; Phenylethaneboronic Acid |
Moleküler Formülü |
C8H9BO2 |
Molekül Ağırlığı |
147.9669 |
InChI |
InChI=1/C8H9BO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7,10-11H/b7-6+ |
CAS kayıt numarası |
34420-17-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.13g/cm3 |
Kaynama noktası |
315.9°C at 760 mmHg |
Kırılma indisi |
1.587 |
Alevlenme noktası |
144.9°C |
Buhar basıncı |
0.000179mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|