ChemNet > CAS > 3445-84-9 N, N-Bis (2-siyanoetil) formamid
3445-84-9 N, N-Bis (2-siyanoetil) formamid
| Ürün Adı |
N, N-Bis (2-siyanoetil) formamid |
| Eş anlamlı |
3,3- (Formilimino) dipropionitril; NN-Bis (2-siyanoetil) formamid, Uygulama;
|
| ingilizce adı |
N,N-Bis(2-cyanoethyl)formamide; 3,3-(Formylimino)dipropionitrile; NN-Bis(2-cyanoethyl)formamide, Pract. |
| Moleküler Formülü |
C7H9N3O |
| Molekül Ağırlığı |
151.1659 |
| InChI |
InChI=1/C7H9N3O/c8-3-1-5-10(7-11)6-2-4-9/h7H,1-2,5-6H2 |
| CAS kayıt numarası |
3445-84-9 |
| EINECS |
222-362-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.116g/cm3 |
| Kaynama noktası |
444.1°C at 760 mmHg |
| Kırılma indisi |
1.476 |
| Alevlenme noktası |
222.4°C |
| Buhar basıncı |
4.39E-08mmHg at 25°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|
