ChemNet > CAS > 345-70-0 3,3'-difluorobenzophenone
345-70-0 3,3'-difluorobenzophenone
Ürün Adı |
3,3'-difluorobenzophenone |
ingilizce adı |
3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone |
Moleküler Formülü |
C13H8F2O |
Molekül Ağırlığı |
218.1988 |
InChI |
InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H |
CAS kayıt numarası |
345-70-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.239g/cm3 |
Ergime noktası |
56-59℃ |
Kaynama noktası |
316.2°C at 760 mmHg |
Kırılma indisi |
1.549 |
Alevlenme noktası |
121.3°C |
Buhar basıncı |
0.000415mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|