3468-53-9 Phenyl nicotinate
Ürün Adı |
Phenyl nicotinate |
ingilizce adı |
Phenyl nicotinate; Phenyl nicotinate, (Nicotinic acid phenyl ester; Nicotinic acid phenyl ester~Phenyl pyridine-3-carboxylate; phenyl pyridine-3-carboxylate |
Moleküler Formülü |
C12H9NO2 |
Molekül Ağırlığı |
199.2054 |
InChI |
InChI=1/C12H9NO2/c14-12(10-5-4-8-13-9-10)15-11-6-2-1-3-7-11/h1-9H |
CAS kayıt numarası |
3468-53-9 |
EINECS |
222-428-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.199g/cm3 |
Ergime noktası |
70-72℃ |
Kaynama noktası |
338.9°C at 760 mmHg |
Kırılma indisi |
1.589 |
Alevlenme noktası |
158.8°C |
Buhar basıncı |
9.51E-05mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R43:May cause sensitization by skin contact.;
|
Güvenlik Açıklaması |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|