ChemNet > CAS > 3512-13-8 2,3,4,6-Tetrafluoropyridine
3512-13-8 2,3,4,6-Tetrafluoropyridine
| Ürün Adı |
2,3,4,6-Tetrafluoropyridine |
| ingilizce adı |
2,3,4,6-Tetrafluoropyridine; |
| Moleküler Formülü |
C5HF4N |
| Molekül Ağırlığı |
151.0618 |
| InChI |
InChI=1/C5HF4N/c6-2-1-3(7)10-5(9)4(2)8/h1H |
| CAS kayıt numarası |
3512-13-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.518g/cm3 |
| Kaynama noktası |
114.6°C at 760 mmHg |
| Kırılma indisi |
1.403 |
| Alevlenme noktası |
23.1°C |
| Buhar basıncı |
23.4mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
