ChemNet > CAS > 35947-10-5 2-Methyl-1-(3-methylphenyl)piperazine
35947-10-5 2-Methyl-1-(3-methylphenyl)piperazine
Ürün Adı |
2-Methyl-1-(3-methylphenyl)piperazine |
ingilizce adı |
2-Methyl-1-(3-methylphenyl)piperazine; 2-Methyl-1-(m-tolyl)-piperazine; (3S)-3-methyl-4-(3-methylphenyl)piperazin-1-ium; (3R)-3-methyl-4-(3-methylphenyl)piperazin-1-ium |
Moleküler Formülü |
C12H19N2 |
Molekül Ağırlığı |
191.2921 |
InChI |
InChI=1/C12H18N2/c1-10-4-3-5-12(8-10)14-7-6-13-9-11(14)2/h3-5,8,11,13H,6-7,9H2,1-2H3/p+1/t11-/m1/s1 |
CAS kayıt numarası |
35947-10-5 |
EINECS |
252-810-0 |
Moleküler Yapısı |
|
Kaynama noktası |
326.9°C at 760 mmHg |
Alevlenme noktası |
147.4°C |
Buhar basıncı |
0.00021mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|