ChemNet > CAS > 374790-97-3 4-Bromo-3-fluorobenzeneboronic acid
374790-97-3 4-Bromo-3-fluorobenzeneboronic acid
Ürün Adı |
4-Bromo-3-fluorobenzeneboronic acid |
ingilizce adı |
4-Bromo-3-fluorobenzeneboronic acid; 4-Bromo-3-fluorophenylboronic acid |
Moleküler Formülü |
C6H5BBrFO2 |
Molekül Ağırlığı |
218.8161 |
InChI |
InChI=1/C6H5BBrFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H |
CAS kayıt numarası |
374790-97-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.75g/cm3 |
Kaynama noktası |
314.7°C at 760 mmHg |
Kırılma indisi |
1.571 |
Alevlenme noktası |
144.1°C |
Buhar basıncı |
0.000195mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|