ChemNet > CAS > 38464-20-9 4-Chloro-3-nitrocoumarin
38464-20-9 4-Chloro-3-nitrocoumarin
Ürün Adı |
4-Chloro-3-nitrocoumarin |
ingilizce adı |
4-Chloro-3-nitrocoumarin;4-chloro-3-nitro-2H-chromen-2-one |
Moleküler Formülü |
C9H4ClNO4 |
Molekül Ağırlığı |
225.5854 |
InChI |
InChI=1/C9H4ClNO4/c10-7-5-3-1-2-4-6(5)15-9(12)8(7)11(13)14/h1-4H |
CAS kayıt numarası |
38464-20-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.6g/cm3 |
Ergime noktası |
160-164℃ |
Kaynama noktası |
338.7°C at 760 mmHg |
Kırılma indisi |
1.642 |
Alevlenme noktası |
158.6°C |
Buhar basıncı |
9.68E-05mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|