ChemNet > CAS > 4004-95-9 1-fenilpiperazin dihidroklorür
4004-95-9 1-fenilpiperazin dihidroklorür
| Ürün Adı |
1-fenilpiperazin dihidroklorür |
| Eş anlamlı |
1-Fenilpiperazin dihidroklorür; 1-Fenilpiperazin HCl
|
| ingilizce adı |
1-phenylpiperazine dihydrochloride;1-Phenylpiperazine dihydrochloride; 1-Phenylpiperazine HCl |
| Moleküler Formülü |
C10H16Cl2N2 |
| Molekül Ağırlığı |
235.1534 |
| InChI |
InChI=1/C10H14N2.2ClH/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;;/h1-5,11H,6-9H2;2*1H |
| CAS kayıt numarası |
4004-95-9 |
| EINECS |
223-654-0 |
| Moleküler Yapısı |
|
| Kaynama noktası |
287.2°C at 760 mmHg |
| Alevlenme noktası |
138.3°C |
| Buhar basıncı |
0.00252mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
