ChemNet > CAS > 401-56-9 ethylchlorofluoroacetate
401-56-9 ethylchlorofluoroacetate
| Ürün Adı |
ethylchlorofluoroacetate |
| ingilizce adı |
ethylchlorofluoroacetate; Ethyl chlorofluoroacetate; Chlorofluoroacetic acid ethyl ester; ethyl (2S)-chloro(fluoro)ethanoate; ethyl (2R)-chloro(fluoro)ethanoate |
| Moleküler Formülü |
C4H6ClFO2 |
| Molekül Ağırlığı |
140.5406 |
| InChI |
InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
| CAS kayıt numarası |
401-56-9 |
| EINECS |
206-930-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.219g/cm3 |
| Kaynama noktası |
129°C at 760 mmHg |
| Kırılma indisi |
1.39 |
| Alevlenme noktası |
44.3°C |
| Buhar basıncı |
10.4mmHg at 25°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
