ChemNet > CAS > 40594-30-7 2,4-difluorophenylhydrazine
40594-30-7 2,4-difluorophenylhydrazine
| Ürün Adı |
2,4-difluorophenylhydrazine |
| ingilizce adı |
2,4-difluorophenylhydrazine; 1-(2,4-Difluorophenyl)hydrazine; (2,4-difluorophenyl)hydrazine hydrochloride |
| Moleküler Formülü |
C6H7ClF2N2 |
| Molekül Ağırlığı |
180.583 |
| InChI |
InChI=1/C6H6F2N2.ClH/c7-4-1-2-6(10-9)5(8)3-4;/h1-3,10H,9H2;1H |
| CAS kayıt numarası |
40594-30-7 |
| Moleküler Yapısı |
|
| Ergime noktası |
65-67℃ |
| Kaynama noktası |
185.1°C at 760 mmHg |
| Alevlenme noktası |
65.7°C |
| Buhar basıncı |
0.71mmHg at 25°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
