ChemNet > CAS > 41513-32-0 trans-1,4-Sikloheksandiol
41513-32-0 trans-1,4-Sikloheksandiol
| Ürün Adı |
trans-1,4-Sikloheksandiol |
| Eş anlamlı |
(1S, 4S) -sikloheks-2-en-1,4-diol; (1R, 4S) -sikloheks-2-en-1,4-diol; (1R, 4R) -sikloheks-2-en-1,4-diol;
|
| ingilizce adı |
trans-1,4-Cyclohexenediol;(1S,4S)-cyclohex-2-ene-1,4-diol; (1R,4S)-cyclohex-2-ene-1,4-diol; (1R,4R)-cyclohex-2-ene-1,4-diol |
| Moleküler Formülü |
C6H10O2 |
| Molekül Ağırlığı |
114.1424 |
| InChI |
InChI=1/C6H10O2/c7-5-1-2-6(8)4-3-5/h1-2,5-8H,3-4H2/t5-,6-/m0/s1 |
| CAS kayıt numarası |
41513-32-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.217g/cm3 |
| Ergime noktası |
84-87℃ |
| Kaynama noktası |
242.8°C at 760 mmHg |
| Kırılma indisi |
1.563 |
| Alevlenme noktası |
119.3°C |
| Buhar basıncı |
0.00565mmHg at 25°C |
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|