ChemNet > CAS > 41963-20-6 4-Bromo-3-methylbenzonitrile
41963-20-6 4-Bromo-3-methylbenzonitrile
| Ürün Adı |
4-Bromo-3-methylbenzonitrile |
| ingilizce adı |
4-Bromo-3-methylbenzonitrile; 4-Bromo-m-tolunitrile (CN=1); 3-Methyl-4-bromobenzonitrile |
| Moleküler Formülü |
C8H6BrN |
| Molekül Ağırlığı |
196.0439 |
| InChI |
InChI=1/C8H6BrN/c1-6-4-7(5-10)2-3-8(6)9/h2-4H,1H3 |
| CAS kayıt numarası |
41963-20-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.51g/cm3 |
| Kaynama noktası |
265°C at 760 mmHg |
| Kırılma indisi |
1.59 |
| Alevlenme noktası |
114.1°C |
| Buhar basıncı |
0.00937mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
