ChemNet > CAS > 43036-07-3 4-Asetamidoanilin hidroklorür
43036-07-3 4-Asetamidoanilin hidroklorür
| Ürün Adı |
4-Asetamidoanilin hidroklorür |
| Eş anlamlı |
; 4-Aminoasetanilid hidroklorür; N-Asetil-p-fenilendiamin hidroklorür; N- (4-aminofenil) asetamid hidroklorür (1: 1);
|
| ingilizce adı |
4-Acetamidoaniline hydrochloride; 4-Aminoacetanilide hydrochloride; N-Acetyl-p-phenylenediamine hydrochloride; N-(4-aminophenyl)acetamide hydrochloride (1:1) |
| Moleküler Formülü |
C8H11ClN2O |
| Molekül Ağırlığı |
186.6387 |
| InChI |
InChI=1/C8H10N2O.ClH/c1-6(11)10-8-4-2-7(9)3-5-8;/h2-5H,9H2,1H3,(H,10,11);1H |
| CAS kayıt numarası |
43036-07-3 |
| EINECS |
256-052-1 |
| Moleküler Yapısı |
|
| Kaynama noktası |
267.7°C at 760 mmHg |
| Alevlenme noktası |
115.7°C |
| Buhar basıncı |
0.00802mmHg at 25°C |
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|