ChemNet > CAS > 4395-87-3 4-Isopropylphenylacetonitrile
4395-87-3 4-Isopropylphenylacetonitrile
| Ürün Adı |
4-Isopropylphenylacetonitrile |
| ingilizce adı |
4-Isopropylphenylacetonitrile; [4-(propan-2-yl)phenyl]acetonitrile; 4-Isopropylphenylaceotnitrile |
| Moleküler Formülü |
C11H13N |
| Molekül Ağırlığı |
159.2276 |
| InChI |
InChI=1/C11H13N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3-6,9H,7H2,1-2H3 |
| CAS kayıt numarası |
4395-87-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.96g/cm3 |
| Kaynama noktası |
261.1°C at 760 mmHg |
| Kırılma indisi |
1.514 |
| Alevlenme noktası |
117.5°C |
| Buhar basıncı |
0.0118mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|
