ChemNet > CAS > 4472-41-7 N,N-Dimethylformamide-d7
4472-41-7 N,N-Dimethylformamide-d7
| Ürün Adı |
N,N-Dimethylformamide-d7 |
| ingilizce adı |
N,N-Dimethylformamide-d7; Dimethylformamidedisotopicpurity; N,N-bis[(~2~H_3_)methyl](~2~H)formamide; N,N-bis[(~2~H_3_)methyl]formamide |
| Moleküler Formülü |
C3HD6NO |
| Molekül Ağırlığı |
79.1308 |
| InChI |
InChI=1/C3H7NO/c1-4(2)3-5/h3H,1-2H3/i1D3,2D3 |
| CAS kayıt numarası |
4472-41-7 |
| EINECS |
224-745-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.958g/cm3 |
| Kaynama noktası |
152.999°C at 760 mmHg |
| Kırılma indisi |
1.396 |
| Alevlenme noktası |
57.778°C |
| Buhar basıncı |
3.403mmHg at 25°C |
| Tehlike Sembolleri |
 T:Toxic;
|
| Risk Kodları |
R20/21:Harmful by inhalation and in contact with skin.;
R36:Irritating to eyes.;
R61:May cause harm to the unborn child.;
|
| Güvenlik Açıklaması |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
