ChemNet > CAS > 4476-28-2 4-Isopropylphenylacetic acid
4476-28-2 4-Isopropylphenylacetic acid
| Ürün Adı |
4-Isopropylphenylacetic acid |
| ingilizce adı |
4-Isopropylphenylacetic acid; AI3-12008; Benzeneacetic acid, 4-(1-methylethyl)-; [4-(propan-2-yl)phenyl]acetic acid; [4-(1-methylethyl)phenyl]acetate |
| Moleküler Formülü |
C11H13O2 |
| Molekül Ağırlığı |
177.2203 |
| InChI |
InChI=1/C11H14O2/c1-8(2)10-5-3-9(4-6-10)7-11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13)/p-1 |
| CAS kayıt numarası |
4476-28-2 |
| EINECS |
224-755-2 |
| Moleküler Yapısı |
|
| Kaynama noktası |
295°C at 760 mmHg |
| Alevlenme noktası |
192.1°C |
| Buhar basıncı |
0.00071mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
