ChemNet > CAS > 4511-42-6 L-Lactide S
4511-42-6 L-Lactide S
Ürün Adı |
L-Lactide S |
ingilizce adı |
L-Lactide S; (3S)-cis-3,6-Dimethyl-1,4-dioxane-2,5-dione; Lactide; L-Lactide; (3S)-Cis-3,6-dimethyl-1,4-dioxane-2,5-dione; (S,S)-3,6-Dimethyl-1,4-dioxane-2,5-dione; L-Lactide; 3,6-dimethyl-1,4-dioxane-2,5-dione; (3R,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione; L-(-)-Lactide |
Moleküler Formülü |
C6H8O4 |
Molekül Ağırlığı |
144.1253 |
InChI |
InChI=1/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3/t3-,4+ |
CAS kayıt numarası |
4511-42-6 |
EINECS |
224-832-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.186g/cm3 |
Ergime noktası |
92-98℃ |
Kaynama noktası |
285.5°C at 760 mmHg |
Kırılma indisi |
1.429 |
Alevlenme noktası |
150.6°C |
Buhar basıncı |
0.0028mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37:Irritating to eyes and respiratory system.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|