4534-74-1 4-Ethylcyclohexanol
Ürün Adı |
4-Ethylcyclohexanol |
ingilizce adı |
4-Ethylcyclohexanol; Ethylcyclohexanol; 4-Ethylcyclohexanol, mixture of cis- and trans isomers; Ethyl cyclohexanol |
Moleküler Formülü |
C8H16O |
Molekül Ağırlığı |
128.21 |
InChI |
InChI=1/C8H16O/c1-2-7-3-5-8(9)6-4-7/h7-9H,2-6H2,1H3 |
CAS kayıt numarası |
4534-74-1 |
EINECS |
224-878-1 |
Moleküler Yapısı |
|
Yoğunluk |
0.889 |
Kaynama noktası |
83.4-84.4℃ (10 mmHg) |
Kırılma indisi |
1.461-1.463 |
Alevlenme noktası |
77℃ |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:;
|
|