ChemNet > CAS > 465514-59-4 1- (2,6-diflorofenil) -2-fenil-1-etanon
465514-59-4 1- (2,6-diflorofenil) -2-fenil-1-etanon
| Ürün Adı |
1- (2,6-diflorofenil) -2-fenil-1-etanon |
| Eş anlamlı |
1- (2,6-diflorofenil) -2-feniletilanon;
|
| ingilizce adı |
1-(2,6-difluorophenyl)-2-phenyl-1-ethanone;1-(2,6-difluorophenyl)-2-phenylethanone |
| Moleküler Formülü |
C14H10F2O |
| Molekül Ağırlığı |
232.2254 |
| InChI |
InChI=1/C14H10F2O/c15-11-7-4-8-12(16)14(11)13(17)9-10-5-2-1-3-6-10/h1-8H,9H2 |
| CAS kayıt numarası |
465514-59-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.221g/cm3 |
| Kaynama noktası |
317.6°C at 760 mmHg |
| Kırılma indisi |
1.552 |
| Alevlenme noktası |
121.8°C |
| Buhar basıncı |
0.000381mmHg at 25°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
