ChemNet > CAS > 4693-91-8 4-methoxyphenylacetyl chloride
4693-91-8 4-methoxyphenylacetyl chloride
| Ürün Adı |
4-methoxyphenylacetyl chloride |
| ingilizce adı |
4-methoxyphenylacetyl chloride; Benzenacetyl chloride, 4-methoxy-; (p-Methoxyphenyl)acetyl chloride; (4-Methoxyphenyl)acetylchloride |
| Moleküler Formülü |
C9H9ClO2 |
| Molekül Ağırlığı |
184.6196 |
| InChI |
InChI=1/C9H9ClO2/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3 |
| CAS kayıt numarası |
4693-91-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.192g/cm3 |
| Kaynama noktası |
280.1°C at 760 mmHg |
| Kırılma indisi |
1.524 |
| Alevlenme noktası |
100°C |
| Buhar basıncı |
0.00387mmHg at 25°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
