4712-55-4 Diphenyl phosphite
Ürün Adı |
Diphenyl phosphite |
ingilizce adı |
Diphenyl phosphite; diphenyl phosphonate; Phosphonic acid diphenyl ester; diphenyl hydrogen phosphite; oxo(diphenoxy)phosphonium |
Moleküler Formülü |
C12H11O3P |
Molekül Ağırlığı |
234.1877 |
InChI |
InChI=1/C12H11O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,16H |
CAS kayıt numarası |
4712-55-4 |
EINECS |
225-202-8 |
Moleküler Yapısı |
|
Ergime noktası |
12℃ |
Kaynama noktası |
348.233°C at 760 mmHg |
Alevlenme noktası |
178.834°C |
Buhar basıncı |
0mmHg at 25°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|