ChemNet > CAS > 4755-50-4 4-Dimethylaminobenzoylchloride
4755-50-4 4-Dimethylaminobenzoylchloride
| Ürün Adı |
4-Dimethylaminobenzoylchloride |
| ingilizce adı |
4-Dimethylaminobenzoylchloride; 4-Dimethylaminobenzoyl chloride; 4-(ethylamino)benzoyl chloride |
| Moleküler Formülü |
C9H10ClNO |
| Molekül Ağırlığı |
183.6348 |
| InChI |
InChI=1/C9H10ClNO/c1-11(2)8-5-3-7(4-6-8)9(10)12/h3-6H,1-2H3 |
| CAS kayıt numarası |
4755-50-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.193g/cm3 |
| Kaynama noktası |
279°C at 760 mmHg |
| Kırılma indisi |
1.574 |
| Alevlenme noktası |
122.5°C |
| Buhar basıncı |
0.00412mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
