ChemNet > CAS > 4837-20-1 4-(difluoromethoxy)benzoic acid
4837-20-1 4-(difluoromethoxy)benzoic acid
| Ürün Adı |
4-(difluoromethoxy)benzoic acid |
| ingilizce adı |
4-(difluoromethoxy)benzoic acid;4-(difluoromethoxy)benzoate |
| Moleküler Formülü |
C8H5F2O3 |
| Molekül Ağırlığı |
187.1209 |
| InChI |
InChI=1/C8H6F2O3/c9-8(10)13-6-3-1-5(2-4-6)7(11)12/h1-4,8H,(H,11,12)/p-1 |
| CAS kayıt numarası |
4837-20-1 |
| Moleküler Yapısı |
|
| Ergime noktası |
169-171℃ |
| Kaynama noktası |
272.1°C at 760 mmHg |
| Alevlenme noktası |
118.3°C |
| Buhar basıncı |
0.00304mmHg at 25°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
