ChemNet > CAS > 4900-63-4 1-Methoxy-4-nitronaphthalene
4900-63-4 1-Methoxy-4-nitronaphthalene
| Ürün Adı |
1-Methoxy-4-nitronaphthalene |
| ingilizce adı |
1-Methoxy-4-nitronaphthalene; methyl 4-nitronaphthyl ether |
| Moleküler Formülü |
C11H9NO3 |
| Molekül Ağırlığı |
203.1941 |
| InChI |
InChI=1/C11H9NO3/c1-15-11-7-6-10(12(13)14)8-4-2-3-5-9(8)11/h2-7H,1H3 |
| CAS kayıt numarası |
4900-63-4 |
| EINECS |
225-528-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.274g/cm3 |
| Ergime noktası |
83-85℃ |
| Kaynama noktası |
367.2°C at 760 mmHg |
| Kırılma indisi |
1.638 |
| Alevlenme noktası |
178.3°C |
| Buhar basıncı |
2.93E-05mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
