ChemNet > CAS > 4946-14-9 p-isoPropyl Thiophenol
4946-14-9 p-isoPropyl Thiophenol
| Ürün Adı |
p-isoPropyl Thiophenol |
| ingilizce adı |
p-isoPropyl Thiophenol; 4-Isopropylthiophenol; 4-Isopropylbenzenethiol; 4-(propan-2-yl)benzenethiol; 4-(1-methylethyl)benzenethiolate; (4-Isopropyl)thiophenol |
| Moleküler Formülü |
C9H11S |
| Molekül Ağırlığı |
151.2492 |
| InChI |
InChI=1/C9H12S/c1-7(2)8-3-5-9(10)6-4-8/h3-7,10H,1-2H3/p-1 |
| CAS kayıt numarası |
4946-14-9 |
| Moleküler Yapısı |
|
| Kaynama noktası |
215.1°C at 760 mmHg |
| Alevlenme noktası |
86.4°C |
| Buhar basıncı |
0.22mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
